C13H15BO2 — CID 11665663
2-(4-ethynylphenyl)-5,5-dimethyl-1,3,2-dioxaborinane (PubChem CID 11665663) has the molecular formula C13H15BO2 and a molecular weight of 214.07 g/mol. Its IUPAC name is 2-(4-ethynylphenyl)-5,5-dimethyl-1,3,2-dioxaborinane.
| Compound Name | 2-(4-ethynylphenyl)-5,5-dimethyl-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 11665663 |
| Molecular Formula | C13H15BO2 |
| Molecular Weight | 214.07 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 2-(4-ethynylphenyl)-5,5-dimethyl-1,3,2-dioxaborinane |
| SMILES | C#Cc1ccc(B2OCC(C)(C)CO2)cc1 |
| InChI | InChI=1S/C13H15BO2/c1-4-11-5-7-12(8-6-11)14-15-9-13(2,3)10-16-14/h1,5-8H,9-10H2,2-3H3 |
| InChIKey | PSUZUFSRSCKEQD-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.07 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|