C18H17BFNO2 — CID 22285322
4-[5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2-fluorophenyl]benzonitrile (PubChem CID 22285322) has the molecular formula C18H17BFNO2 and a molecular weight of 309.15 g/mol. Its IUPAC name is 4-[5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2-fluorophenyl]benzonitrile.
| Compound Name | 4-[5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2-fluorophenyl]benzonitrile |
|---|---|
| PubChem CID | 22285322 |
| Molecular Formula | C18H17BFNO2 |
| Molecular Weight | 309.15 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 4-[5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2-fluorophenyl]benzonitrile |
| SMILES | CC1(C)COB(c2ccc(F)c(-c3ccc(C#N)cc3)c2)OC1 |
| InChI | InChI=1S/C18H17BFNO2/c1-18(2)11-22-19(23-12-18)15-7-8-17(20)16(9-15)14-5-3-13(10-21)4-6-14/h3-9H,11-12H2,1-2H3 |
| InChIKey | LINKVNFGZSYWQH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.15 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|