C26H21BN4O2 — CID 163522880
4-[4-[4-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]benzonitrile (PubChem CID 163522880) has the molecular formula C26H21BN4O2 and a molecular weight of 432.29 g/mol. Its IUPAC name is 4-[4-[4-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]benzonitrile.
| Compound Name | 4-[4-[4-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 163522880 |
| Molecular Formula | C26H21BN4O2 |
| Molecular Weight | 432.29 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 4-[4-[4-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]benzonitrile |
| SMILES | CC1(C)COB(c2ccc(-c3nc(-c4ccccc4)nc(-c4ccc(C#N)cc4)n3)cc2)O1 |
| InChI | InChI=1S/C26H21BN4O2/c1-26(2)17-32-27(33-26)22-14-12-21(13-15-22)25-30-23(19-6-4-3-5-7-19)29-24(31-25)20-10-8-18(16-28)9-11-20/h3-15H,17H2,1-2H3 |
| InChIKey | DMIZTTWKOFPPAT-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 80.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.29 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|