C22H26BN3O2 — CID 145173153
N-benzyl-N-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoxalin-2-amine (PubChem CID 145173153) has the molecular formula C22H26BN3O2 and a molecular weight of 375.28 g/mol. Its IUPAC name is N-benzyl-N-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoxalin-2-amine.
| Compound Name | N-benzyl-N-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoxalin-2-amine |
|---|---|
| PubChem CID | 145173153 |
| Molecular Formula | C22H26BN3O2 |
| Molecular Weight | 375.28 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | N-benzyl-N-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoxalin-2-amine |
| SMILES | CN(Cc1ccccc1)c1cnc2cc(B3OC(C)(C)C(C)(C)O3)ccc2n1 |
| InChI | InChI=1S/C22H26BN3O2/c1-21(2)22(3,4)28-23(27-21)17-11-12-18-19(13-17)24-14-20(25-18)26(5)15-16-9-7-6-8-10-16/h6-14H,15H2,1-5H3 |
| InChIKey | KSGMCXSAMTUNCH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.28 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|