C23H25N7 — CID 145173162
6-(6-amino-5-methanimidoylpyrimidin-4-yl)-N-benzyl-N-methylquinoxalin-2-amine;ethane (PubChem CID 145173162) has the molecular formula C23H25N7 and a molecular weight of 399.50 g/mol. Its IUPAC name is 6-(6-amino-5-methanimidoylpyrimidin-4-yl)-N-benzyl-N-methylquinoxalin-2-amine;ethane.
| Compound Name | 6-(6-amino-5-methanimidoylpyrimidin-4-yl)-N-benzyl-N-methylquinoxalin-2-amine;ethane |
|---|---|
| PubChem CID | 145173162 |
| Molecular Formula | C23H25N7 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 6-(6-amino-5-methanimidoylpyrimidin-4-yl)-N-benzyl-N-methylquinoxalin-2-amine;ethane |
| SMILES | CC.[H]/N=C/c1c(N)ncnc1-c1ccc2nc(N(C)Cc3ccccc3)cnc2c1 |
| InChI | InChI=1S/C21H19N7.C2H6/c1-28(12-14-5-3-2-4-6-14)19-11-24-18-9-15(7-8-17(18)27-19)20-16(10-22)21(23)26-13-25-20;1-2/h2-11,13,22H,12H2,1H3,(H2,23,25,26);1-2H3/b22-10+; |
| InChIKey | XVPFVCZJHLCEHP-UAONINCZSA-N |
| XLogP | 4.33 |
| TPSA | 104.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|