C22H26BN3O2 — CID 145173152
N-[(1R)-1-phenylethyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoxalin-2-amine (PubChem CID 145173152) has the molecular formula C22H26BN3O2 and a molecular weight of 375.28 g/mol. Its IUPAC name is N-[(1R)-1-phenylethyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoxalin-2-amine.
| Compound Name | N-[(1R)-1-phenylethyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoxalin-2-amine |
|---|---|
| PubChem CID | 145173152 |
| Molecular Formula | C22H26BN3O2 |
| Molecular Weight | 375.28 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | N-[(1R)-1-phenylethyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoxalin-2-amine |
| SMILES | C[C@@H](Nc1cnc2cc(B3OC(C)(C)C(C)(C)O3)ccc2n1)c1ccccc1 |
| InChI | InChI=1S/C22H26BN3O2/c1-15(16-9-7-6-8-10-16)25-20-14-24-19-13-17(11-12-18(19)26-20)23-27-21(2,3)22(4,5)28-23/h6-15H,1-5H3,(H,25,26)/t15-/m1/s1 |
| InChIKey | PQUGSBZZRHIKEK-OAHLLOKOSA-N |
| XLogP | 4.10 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.28 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|