C23H28BN3O2 — CID 174020704
N-(1-phenylpropyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinazolin-4-amine (PubChem CID 174020704) has the molecular formula C23H28BN3O2 and a molecular weight of 389.31 g/mol. Its IUPAC name is N-(1-phenylpropyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinazolin-4-amine.
| Compound Name | N-(1-phenylpropyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinazolin-4-amine |
|---|---|
| PubChem CID | 174020704 |
| Molecular Formula | C23H28BN3O2 |
| Molecular Weight | 389.31 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | N-(1-phenylpropyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinazolin-4-amine |
| SMILES | CCC(Nc1ncnc2ccc(B3OC(C)(C)C(C)(C)O3)cc12)c1ccccc1 |
| InChI | InChI=1S/C23H28BN3O2/c1-6-19(16-10-8-7-9-11-16)27-21-18-14-17(12-13-20(18)25-15-26-21)24-28-22(2,3)23(4,5)29-24/h7-15,19H,6H2,1-5H3,(H,25,26,27) |
| InChIKey | PXTRVJQUAFPJQB-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.31 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|