C18H21BO4 — CID 144987923
2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzene-1,3-diol (PubChem CID 144987923) has the molecular formula C18H21BO4 and a molecular weight of 312.17 g/mol. Its IUPAC name is 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzene-1,3-diol.
| Compound Name | 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 144987923 |
| Molecular Formula | C18H21BO4 |
| Molecular Weight | 312.17 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzene-1,3-diol |
| SMILES | CC1(C)OB(c2ccc(-c3c(O)cccc3O)cc2)OC1(C)C |
| InChI | InChI=1S/C18H21BO4/c1-17(2)18(3,4)23-19(22-17)13-10-8-12(9-11-13)16-14(20)6-5-7-15(16)21/h5-11,20-21H,1-4H3 |
| InChIKey | ZKADHCIKASXXEC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.17 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|