C18H17B5O3 — CID 174044472
CID 174044472 (PubChem CID 174044472) has the molecular formula C18H17B5O3 and a molecular weight of 335.39 g/mol.
| Compound Name | CID 174044472 |
|---|---|
| PubChem CID | 174044472 |
| Molecular Formula | C18H17B5O3 |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c(O)c([B])c(-c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)c1[B] |
| InChI | InChI=1S/C18H17B5O3/c1-17(2)18(3,4)26-23(25-17)10-7-5-9(6-8-10)11-12(19)14(21)15(22)16(24)13(11)20/h5-8,24H,1-4H3 |
| InChIKey | KQZGUOZAIHALLK-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|