C28H22B6O2 — CID 174075977
CID 174075977 (PubChem CID 174075977) has the molecular formula C28H22B6O2 and a molecular weight of 455.35 g/mol.
| Compound Name | CID 174075977 |
|---|---|
| PubChem CID | 174075977 |
| Molecular Formula | C28H22B6O2 |
| Molecular Weight | 455.35 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(-c2ccc3cccc(-c4cccc(B5OC(C)(C)C(C)(C)O5)c4)c3c2)c([B])c1[B] |
| InChI | InChI=1S/C28H22B6O2/c1-27(2)28(3,4)36-34(35-27)18-9-5-8-16(13-18)19-10-6-7-15-11-12-17(14-20(15)19)21-22(29)24(31)26(33)25(32)23(21)30/h5-14H,1-4H3 |
| InChIKey | MYEVBLRZLJOKBG-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.35 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|