C21H31BN4O4 — CID 178108868
2-methyl-5-(1-methylpiperidin-4-yl)oxy-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,4-triazol-3-one (PubChem CID 178108868) has the molecular formula C21H31BN4O4 and a molecular weight of 414.32 g/mol. Its IUPAC name is 2-methyl-5-(1-methylpiperidin-4-yl)oxy-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,4-triazol-3-one.
| Compound Name | 2-methyl-5-(1-methylpiperidin-4-yl)oxy-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 178108868 |
| Molecular Formula | C21H31BN4O4 |
| Molecular Weight | 414.32 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | 2-methyl-5-(1-methylpiperidin-4-yl)oxy-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,4-triazol-3-one |
| SMILES | CN1CCC(Oc2nn(C)c(=O)n2-c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)CC1 |
| InChI | InChI=1S/C21H31BN4O4/c1-20(2)21(3,4)30-22(29-20)15-7-9-16(10-8-15)26-18(23-25(6)19(26)27)28-17-11-13-24(5)14-12-17/h7-10,17H,11-14H2,1-6H3 |
| InChIKey | DGQFUXSGVNNQFR-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 70.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.32 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|