C15H30N2O4SSi — CID 142341621
2-[[5-(2-methoxyethyl)-4-(2-methylsulfonylethyl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 142341621) has the molecular formula C15H30N2O4SSi and a molecular weight of 362.57 g/mol. Its IUPAC name is 2-[[5-(2-methoxyethyl)-4-(2-methylsulfonylethyl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-(2-methoxyethyl)-4-(2-methylsulfonylethyl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 142341621 |
| Molecular Formula | C15H30N2O4SSi |
| Molecular Weight | 362.57 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 2-[[5-(2-methoxyethyl)-4-(2-methylsulfonylethyl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | COCCc1c(CCS(C)(=O)=O)cnn1COCC[Si](C)(C)C |
| InChI | InChI=1S/C15H30N2O4SSi/c1-20-8-6-15-14(7-10-22(2,18)19)12-16-17(15)13-21-9-11-23(3,4)5/h12H,6-11,13H2,1-5H3 |
| InChIKey | SWOBQRRUFKKUOR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.57 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|