C19H31FN2O5SSi — CID 153403198
[6-fluoro-4-[(2-methylpropan-2-yl)oxy]-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methyl methanesulfonate (PubChem CID 153403198) has the molecular formula C19H31FN2O5SSi and a molecular weight of 446.62 g/mol. Its IUPAC name is [6-fluoro-4-[(2-methylpropan-2-yl)oxy]-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methyl methanesulfonate.
| Compound Name | [6-fluoro-4-[(2-methylpropan-2-yl)oxy]-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 153403198 |
| Molecular Formula | C19H31FN2O5SSi |
| Molecular Weight | 446.62 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | [6-fluoro-4-[(2-methylpropan-2-yl)oxy]-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methyl methanesulfonate |
| SMILES | CC(C)(C)Oc1cc(F)cc2c1nc(COS(C)(=O)=O)n2COCC[Si](C)(C)C |
| InChI | InChI=1S/C19H31FN2O5SSi/c1-19(2,3)27-16-11-14(20)10-15-18(16)21-17(12-26-28(4,23)24)22(15)13-25-8-9-29(5,6)7/h10-11H,8-9,12-13H2,1-7H3 |
| InChIKey | QDAUDJJQAJVFCQ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.62 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|