C17H23F5N2O5SSi — CID 153403274
[6-fluoro-4-(1,1,2,2-tetrafluoroethoxy)-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methyl methanesulfonate (PubChem CID 153403274) has the molecular formula C17H23F5N2O5SSi and a molecular weight of 490.52 g/mol. Its IUPAC name is [6-fluoro-4-(1,1,2,2-tetrafluoroethoxy)-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methyl methanesulfonate.
| Compound Name | [6-fluoro-4-(1,1,2,2-tetrafluoroethoxy)-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 153403274 |
| Molecular Formula | C17H23F5N2O5SSi |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | [6-fluoro-4-(1,1,2,2-tetrafluoroethoxy)-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methyl methanesulfonate |
| SMILES | C[Si](C)(C)CCOCn1c(COS(C)(=O)=O)nc2c(OC(F)(F)C(F)F)cc(F)cc21 |
| InChI | InChI=1S/C17H23F5N2O5SSi/c1-30(25,26)28-9-14-23-15-12(24(14)10-27-5-6-31(2,3)4)7-11(18)8-13(15)29-17(21,22)16(19)20/h7-8,16H,5-6,9-10H2,1-4H3 |
| InChIKey | LOMBBANAYKPKLY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|