C26H29F3N4O3Si — CID 157467509
3-amino-1-[[4-[(2,4-difluorophenyl)methoxy]-6-fluoro-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methyl]pyridin-2-one (PubChem CID 157467509) has the molecular formula C26H29F3N4O3Si and a molecular weight of 530.62 g/mol. Its IUPAC name is 3-amino-1-[[4-[(2,4-difluorophenyl)methoxy]-6-fluoro-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methyl]pyridin-2-one.
| Compound Name | 3-amino-1-[[4-[(2,4-difluorophenyl)methoxy]-6-fluoro-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methyl]pyridin-2-one |
|---|---|
| PubChem CID | 157467509 |
| Molecular Formula | C26H29F3N4O3Si |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | 3-amino-1-[[4-[(2,4-difluorophenyl)methoxy]-6-fluoro-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methyl]pyridin-2-one |
| SMILES | C[Si](C)(C)CCOCn1c(Cn2cccc(N)c2=O)nc2c(OCc3ccc(F)cc3F)cc(F)cc21 |
| InChI | InChI=1S/C26H29F3N4O3Si/c1-37(2,3)10-9-35-16-33-22-12-19(28)13-23(36-15-17-6-7-18(27)11-20(17)29)25(22)31-24(33)14-32-8-4-5-21(30)26(32)34/h4-8,11-13H,9-10,14-16,30H2,1-3H3 |
| InChIKey | BUQOJXRDGINDNH-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|