C23H30F2N4O2Si — CID 153402862
3-amino-1-[[4-(1,1-difluoro-2-methylprop-2-enyl)-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methyl]pyridin-2-one (PubChem CID 153402862) has the molecular formula C23H30F2N4O2Si and a molecular weight of 460.60 g/mol. Its IUPAC name is 3-amino-1-[[4-(1,1-difluoro-2-methylprop-2-enyl)-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methyl]pyridin-2-one.
| Compound Name | 3-amino-1-[[4-(1,1-difluoro-2-methylprop-2-enyl)-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methyl]pyridin-2-one |
|---|---|
| PubChem CID | 153402862 |
| Molecular Formula | C23H30F2N4O2Si |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | 3-amino-1-[[4-(1,1-difluoro-2-methylprop-2-enyl)-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]methyl]pyridin-2-one |
| SMILES | C=C(C)C(F)(F)c1cccc2c1nc(Cn1cccc(N)c1=O)n2COCC[Si](C)(C)C |
| InChI | InChI=1S/C23H30F2N4O2Si/c1-16(2)23(24,25)17-8-6-10-19-21(17)27-20(14-28-11-7-9-18(26)22(28)30)29(19)15-31-12-13-32(3,4)5/h6-11H,1,12-15,26H2,2-5H3 |
| InChIKey | HUXWJXUUJMYMGO-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 75.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|