C22H31FN4O2Si — CID 161172142
3-amino-1-[[6-fluoro-7-propyl-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-2-yl]methyl]pyridin-2-one (PubChem CID 161172142) has the molecular formula C22H31FN4O2Si and a molecular weight of 430.60 g/mol. Its IUPAC name is 3-amino-1-[[6-fluoro-7-propyl-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-2-yl]methyl]pyridin-2-one.
| Compound Name | 3-amino-1-[[6-fluoro-7-propyl-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-2-yl]methyl]pyridin-2-one |
|---|---|
| PubChem CID | 161172142 |
| Molecular Formula | C22H31FN4O2Si |
| Molecular Weight | 430.60 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | 3-amino-1-[[6-fluoro-7-propyl-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-2-yl]methyl]pyridin-2-one |
| SMILES | CCCc1c(F)cnc2cc(Cn3cccc(N)c3=O)n(COCC[Si](C)(C)C)c12 |
| InChI | InChI=1S/C22H31FN4O2Si/c1-5-7-17-18(23)13-25-20-12-16(14-26-9-6-8-19(24)22(26)28)27(21(17)20)15-29-10-11-30(2,3)4/h6,8-9,12-13H,5,7,10-11,14-15,24H2,1-4H3 |
| InChIKey | FOWBIVDNZOMWDP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 75.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.60 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|