C22H28F2N2O2Si — CID 157316827
2-[[4-[(2,4-difluorophenoxy)methyl]-2-ethylbenzimidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 157316827) has the molecular formula C22H28F2N2O2Si and a molecular weight of 418.56 g/mol. Its IUPAC name is 2-[[4-[(2,4-difluorophenoxy)methyl]-2-ethylbenzimidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-[(2,4-difluorophenoxy)methyl]-2-ethylbenzimidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 157316827 |
| Molecular Formula | C22H28F2N2O2Si |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 2-[[4-[(2,4-difluorophenoxy)methyl]-2-ethylbenzimidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CCc1nc2c(COc3ccc(F)cc3F)cccc2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C22H28F2N2O2Si/c1-5-21-25-22-16(14-28-20-10-9-17(23)13-18(20)24)7-6-8-19(22)26(21)15-27-11-12-29(2,3)4/h6-10,13H,5,11-12,14-15H2,1-4H3 |
| InChIKey | AUIOJRYRLBIFHQ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|