C14H19F2IN2O3SSi — CID 71074304
2-[(4,6-difluoro-5-iodo-2-methylsulfonylbenzimidazol-1-yl)methoxy]ethyl-trimethylsilane (PubChem CID 71074304) has the molecular formula C14H19F2IN2O3SSi and a molecular weight of 488.37 g/mol. Its IUPAC name is 2-[(4,6-difluoro-5-iodo-2-methylsulfonylbenzimidazol-1-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(4,6-difluoro-5-iodo-2-methylsulfonylbenzimidazol-1-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 71074304 |
| Molecular Formula | C14H19F2IN2O3SSi |
| Molecular Weight | 488.37 g/mol |
| Exact Mass | 487.99 |
| IUPAC Name | 2-[(4,6-difluoro-5-iodo-2-methylsulfonylbenzimidazol-1-yl)methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1c(S(C)(=O)=O)nc2c(F)c(I)c(F)cc21 |
| InChI | InChI=1S/C14H19F2IN2O3SSi/c1-23(20,21)14-18-13-10(7-9(15)12(17)11(13)16)19(14)8-22-5-6-24(2,3)4/h7H,5-6,8H2,1-4H3 |
| InChIKey | WICMXEDHZBKUOE-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|