C26H42F2N2O5Si2 — CID 123756088
2-[[2-[(2-tert-butyl-2-propan-2-yl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxasilin-7-yl)oxy]-4,6-difluoro-5-methylbenzimidazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 123756088) has the molecular formula C26H42F2N2O5Si2 and a molecular weight of 556.80 g/mol. Its IUPAC name is 2-[[2-[(2-tert-butyl-2-propan-2-yl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxasilin-7-yl)oxy]-4,6-difluoro-5-methylbenzimidazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2-[(2-tert-butyl-2-propan-2-yl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxasilin-7-yl)oxy]-4,6-difluoro-5-methylbenzimidazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 123756088 |
| Molecular Formula | C26H42F2N2O5Si2 |
| Molecular Weight | 556.80 g/mol |
| Exact Mass | 556.26 |
| IUPAC Name | 2-[[2-[(2-tert-butyl-2-propan-2-yl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxasilin-7-yl)oxy]-4,6-difluoro-5-methylbenzimidazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cc1c(F)cc2c(nc(OC3COC4CO[Si](C(C)C)(C(C)(C)C)OC43)n2COCC[Si](C)(C)C)c1F |
| InChI | InChI=1S/C26H42F2N2O5Si2/c1-16(2)37(26(4,5)6)33-14-20-24(35-37)21(13-32-20)34-25-29-23-19(12-18(27)17(3)22(23)28)30(25)15-31-10-11-36(7,8)9/h12,16,20-21,24H,10-11,13-15H2,1-9H3 |
| InChIKey | IWLXUENJLFVUDQ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 63.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.80 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|