About 3-trimethylsilylpropyl benzenesulfonate
3-trimethylsilylpropyl benzenesulfonate (PubChem CID 21102851) has the molecular formula C12H20O3SSi
and a molecular weight of 272.44 g/mol. Its IUPAC name is 3-trimethylsilylpropyl benzenesulfonate.
Molecular Properties
| Compound Name | 3-trimethylsilylpropyl benzenesulfonate |
| PubChem CID | 21102851 |
| Molecular Formula | C12H20O3SSi |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 3-trimethylsilylpropyl benzenesulfonate |
| SMILES | C[Si](C)(C)CCCOS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H20O3SSi/c1-17(2,3)11-7-10-15-16(13,14)12-8-5-4-6-9-12/h4-6,8-9H,7,10-11H2,1-3H3 |
| InChIKey | IKAZKYYFWJLRIS-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 3-trimethylsilylpropyl benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-trimethylsilylpropyl benzenesulfonate?
The IUPAC name of 3-trimethylsilylpropyl benzenesulfonate (CID 21102851) is 3-trimethylsilylpropyl benzenesulfonate.
What is the SMILES notation for 3-trimethylsilylpropyl benzenesulfonate?
The canonical SMILES for 3-trimethylsilylpropyl benzenesulfonate is C[Si](C)(C)CCCOS(=O)(=O)c1ccccc1.
What is the InChIKey of 3-trimethylsilylpropyl benzenesulfonate?
The InChIKey is IKAZKYYFWJLRIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O3SSi/c1-17(2,3)11-7-10-15-16(13,14)12-8-5-4-6-9-12/h4-6,8-9H,7,10-11H2,1-3H3.
What are the key properties of 3-trimethylsilylpropyl benzenesulfonate?
3-trimethylsilylpropyl benzenesulfonate has a molecular weight of 272.44 g/mol, XLogP of 3.12, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-trimethylsilylpropyl benzenesulfonate is sourced from PubChem (CID 21102851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).