C18H27N2O2PSi — CID 135064926
2-[[5-[cyclopropyl(phenyl)phosphoryl]pyrazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 135064926) has the molecular formula C18H27N2O2PSi and a molecular weight of 362.49 g/mol. Its IUPAC name is 2-[[5-[cyclopropyl(phenyl)phosphoryl]pyrazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-[cyclopropyl(phenyl)phosphoryl]pyrazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 135064926 |
| Molecular Formula | C18H27N2O2PSi |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 2-[[5-[cyclopropyl(phenyl)phosphoryl]pyrazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1nccc1P(=O)(c1ccccc1)C1CC1 |
| InChI | InChI=1S/C18H27N2O2PSi/c1-24(2,3)14-13-22-15-20-18(11-12-19-20)23(21,17-9-10-17)16-7-5-4-6-8-16/h4-8,11-12,17H,9-10,13-15H2,1-3H3 |
| InChIKey | FXBFFTULNHPWKN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|