C20H31N2O5PSi — CID 135063583
ethyl 5-[ethoxy(phenyl)phosphoryl]-1-(2-trimethylsilylethoxymethyl)pyrazole-4-carboxylate (PubChem CID 135063583) has the molecular formula C20H31N2O5PSi and a molecular weight of 438.54 g/mol. Its IUPAC name is ethyl 5-[ethoxy(phenyl)phosphoryl]-1-(2-trimethylsilylethoxymethyl)pyrazole-4-carboxylate.
| Compound Name | ethyl 5-[ethoxy(phenyl)phosphoryl]-1-(2-trimethylsilylethoxymethyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 135063583 |
| Molecular Formula | C20H31N2O5PSi |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | ethyl 5-[ethoxy(phenyl)phosphoryl]-1-(2-trimethylsilylethoxymethyl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(COCC[Si](C)(C)C)c1P(=O)(OCC)c1ccccc1 |
| InChI | InChI=1S/C20H31N2O5PSi/c1-6-26-20(23)18-15-21-22(16-25-13-14-29(3,4)5)19(18)28(24,27-7-2)17-11-9-8-10-12-17/h8-12,15H,6-7,13-14,16H2,1-5H3 |
| InChIKey | PVZYESZBJONNLW-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|