C38H44N4O5Si — CID 177286878
ethyl 7-[(1S)-1-[methyl-(4-phenylbenzoyl)amino]-2-phenylmethoxyethyl]-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridine-4-carboxylate (PubChem CID 177286878) has the molecular formula C38H44N4O5Si and a molecular weight of 664.88 g/mol. Its IUPAC name is ethyl 7-[(1S)-1-[methyl-(4-phenylbenzoyl)amino]-2-phenylmethoxyethyl]-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridine-4-carboxylate.
| Compound Name | ethyl 7-[(1S)-1-[methyl-(4-phenylbenzoyl)amino]-2-phenylmethoxyethyl]-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 177286878 |
| Molecular Formula | C38H44N4O5Si |
| Molecular Weight | 664.88 g/mol |
| Exact Mass | 664.31 |
| IUPAC Name | ethyl 7-[(1S)-1-[methyl-(4-phenylbenzoyl)amino]-2-phenylmethoxyethyl]-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridine-4-carboxylate |
| SMILES | CCOC(=O)c1ncc([C@@H](COCc2ccccc2)N(C)C(=O)c2ccc(-c3ccccc3)cc2)c2c1cnn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C38H44N4O5Si/c1-6-47-38(44)35-33-24-40-42(27-45-21-22-48(3,4)5)36(33)32(23-39-35)34(26-46-25-28-13-9-7-10-14-28)41(2)37(43)31-19-17-30(18-20-31)29-15-11-8-12-16-29/h7-20,23-24,34H,6,21-22,25-27H2,1-5H3/t34-/m1/s1 |
| InChIKey | PBZDAYRIAMZISL-UUWRZZSWSA-N |
| XLogP | 7.62 |
| TPSA | 95.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.88 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|