C31H40FN4O5Si+ — CID 169292770
3-ethoxy-4-(3-fluorophenyl)-N-[1-[5-hydroxy-4-(hydroxymethyl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-5-ium-7-yl]ethyl]-N-methylbenzamide (PubChem CID 169292770) has the molecular formula C31H40FN4O5Si+ and a molecular weight of 595.77 g/mol. Its IUPAC name is 3-ethoxy-4-(3-fluorophenyl)-N-[1-[5-hydroxy-4-(hydroxymethyl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-5-ium-7-yl]ethyl]-N-methylbenzamide.
| Compound Name | 3-ethoxy-4-(3-fluorophenyl)-N-[1-[5-hydroxy-4-(hydroxymethyl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-5-ium-7-yl]ethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 169292770 |
| Molecular Formula | C31H40FN4O5Si+ |
| Molecular Weight | 595.77 g/mol |
| Exact Mass | 595.27 |
| IUPAC Name | 3-ethoxy-4-(3-fluorophenyl)-N-[1-[5-hydroxy-4-(hydroxymethyl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]pyridin-5-ium-7-yl]ethyl]-N-methylbenzamide |
| SMILES | CCOc1cc(C(=O)N(C)C(C)c2c[n+](O)c(CO)c3cnn(COCC[Si](C)(C)C)c23)ccc1-c1cccc(F)c1 |
| InChI | InChI=1S/C31H40FN4O5Si/c1-7-41-29-16-23(11-12-25(29)22-9-8-10-24(32)15-22)31(38)34(3)21(2)27-18-36(39)28(19-37)26-17-33-35(30(26)27)20-40-13-14-42(4,5)6/h8-12,15-18,21,37,39H,7,13-14,19-20H2,1-6H3/q+1 |
| InChIKey | UYAVFMDNXSKKMY-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 100.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.77 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|