C26H23FN4O2 — CID 170521505
3-ethoxy-4-(3-fluorophenyl)-N-[1-(4-isocyano-1H-indazol-7-yl)ethyl]-N-methylbenzamide (PubChem CID 170521505) has the molecular formula C26H23FN4O2 and a molecular weight of 442.49 g/mol. Its IUPAC name is 3-ethoxy-4-(3-fluorophenyl)-N-[1-(4-isocyano-1H-indazol-7-yl)ethyl]-N-methylbenzamide.
| Compound Name | 3-ethoxy-4-(3-fluorophenyl)-N-[1-(4-isocyano-1H-indazol-7-yl)ethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 170521505 |
| Molecular Formula | C26H23FN4O2 |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 3-ethoxy-4-(3-fluorophenyl)-N-[1-(4-isocyano-1H-indazol-7-yl)ethyl]-N-methylbenzamide |
| SMILES | [C-]#[N+]c1ccc(C(C)N(C)C(=O)c2ccc(-c3cccc(F)c3)c(OCC)c2)c2[nH]ncc12 |
| InChI | InChI=1S/C26H23FN4O2/c1-5-33-24-14-18(9-10-21(24)17-7-6-8-19(27)13-17)26(32)31(4)16(2)20-11-12-23(28-3)22-15-29-30-25(20)22/h6-16H,5H2,1-2,4H3,(H,29,30) |
| InChIKey | OGOBPSVYYYXLQJ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|