C28H31FN4O3 — CID 177350230
(3R)-3-[[3-ethoxy-4-(3-fluorophenyl)benzoyl]-methylamino]-3-(1H-indazol-7-yl)-N,N-dimethylpropan-1-amine oxide (PubChem CID 177350230) has the molecular formula C28H31FN4O3 and a molecular weight of 490.58 g/mol. Its IUPAC name is (3R)-3-[[3-ethoxy-4-(3-fluorophenyl)benzoyl]-methylamino]-3-(1H-indazol-7-yl)-N,N-dimethylpropan-1-amine oxide.
| Compound Name | (3R)-3-[[3-ethoxy-4-(3-fluorophenyl)benzoyl]-methylamino]-3-(1H-indazol-7-yl)-N,N-dimethylpropan-1-amine oxide |
|---|---|
| PubChem CID | 177350230 |
| Molecular Formula | C28H31FN4O3 |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | (3R)-3-[[3-ethoxy-4-(3-fluorophenyl)benzoyl]-methylamino]-3-(1H-indazol-7-yl)-N,N-dimethylpropan-1-amine oxide |
| SMILES | CCOc1cc(C(=O)N(C)[C@H](CC[N+](C)(C)[O-])c2cccc3cn[nH]c23)ccc1-c1cccc(F)c1 |
| InChI | InChI=1S/C28H31FN4O3/c1-5-36-26-17-20(12-13-23(26)19-8-6-10-22(29)16-19)28(34)32(2)25(14-15-33(3,4)35)24-11-7-9-21-18-30-31-27(21)24/h6-13,16-18,25H,5,14-15H2,1-4H3,(H,30,31)/t25-/m1/s1 |
| InChIKey | DMIVOSLIWHKCGR-RUZDIDTESA-N |
| XLogP | 5.55 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|