C29H35ClN5O3+ — CID 177350331
[3-[[4-(3-chlorophenyl)-3-ethoxybenzoyl]-methylamino]-3-(1H-pyrazolo[4,3-c]pyridin-7-yl)propyl]-diethyl-hydroxyazanium (PubChem CID 177350331) has the molecular formula C29H35ClN5O3+ and a molecular weight of 537.08 g/mol. Its IUPAC name is [3-[[4-(3-chlorophenyl)-3-ethoxybenzoyl]-methylamino]-3-(1H-pyrazolo[4,3-c]pyridin-7-yl)propyl]-diethyl-hydroxyazanium.
| Compound Name | [3-[[4-(3-chlorophenyl)-3-ethoxybenzoyl]-methylamino]-3-(1H-pyrazolo[4,3-c]pyridin-7-yl)propyl]-diethyl-hydroxyazanium |
|---|---|
| PubChem CID | 177350331 |
| Molecular Formula | C29H35ClN5O3+ |
| Molecular Weight | 537.08 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | [3-[[4-(3-chlorophenyl)-3-ethoxybenzoyl]-methylamino]-3-(1H-pyrazolo[4,3-c]pyridin-7-yl)propyl]-diethyl-hydroxyazanium |
| SMILES | CCOc1cc(C(=O)N(C)C(CC[N+](O)(CC)CC)c2cncc3cn[nH]c23)ccc1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C29H35ClN5O3/c1-5-35(37,6-2)14-13-26(25-19-31-17-22-18-32-33-28(22)25)34(4)29(36)21-11-12-24(27(16-21)38-7-3)20-9-8-10-23(30)15-20/h8-12,15-19,26,37H,5-7,13-14H2,1-4H3,(H,32,33)/q+1 |
| InChIKey | FSIPGQOFJSLTPB-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.08 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|