C34H44N4O4Si — CID 123338244
tert-butyl 2,2-dimethyl-3-[[5-[4-[5-phenyl-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-2-pyridinyl]oxy]propanoate (PubChem CID 123338244) has the molecular formula C34H44N4O4Si and a molecular weight of 600.84 g/mol. Its IUPAC name is tert-butyl 2,2-dimethyl-3-[[5-[4-[5-phenyl-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-2-pyridinyl]oxy]propanoate.
| Compound Name | tert-butyl 2,2-dimethyl-3-[[5-[4-[5-phenyl-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-2-pyridinyl]oxy]propanoate |
|---|---|
| PubChem CID | 123338244 |
| Molecular Formula | C34H44N4O4Si |
| Molecular Weight | 600.84 g/mol |
| Exact Mass | 600.31 |
| IUPAC Name | tert-butyl 2,2-dimethyl-3-[[5-[4-[5-phenyl-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-2-pyridinyl]oxy]propanoate |
| SMILES | CC(C)(C)OC(=O)C(C)(C)COc1ccc(-c2ccc(-c3nc(-c4ccccc4)nn3COCC[Si](C)(C)C)cc2)cn1 |
| InChI | InChI=1S/C34H44N4O4Si/c1-33(2,3)42-32(39)34(4,5)23-41-29-19-18-28(22-35-29)25-14-16-27(17-15-25)31-36-30(26-12-10-9-11-13-26)37-38(31)24-40-20-21-43(6,7)8/h9-19,22H,20-21,23-24H2,1-8H3 |
| InChIKey | NQZCPBAOTDHKPO-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 88.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.84 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|