C27H36F3N5O5Si — CID 123283965
methyl 2,2-dimethyl-3-[[4-methyl-5-[5-[5-(2,2,2-trifluoroethoxy)-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]-2-pyridinyl]-2-pyridinyl]oxy]propanoate (PubChem CID 123283965) has the molecular formula C27H36F3N5O5Si and a molecular weight of 595.70 g/mol. Its IUPAC name is methyl 2,2-dimethyl-3-[[4-methyl-5-[5-[5-(2,2,2-trifluoroethoxy)-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]-2-pyridinyl]-2-pyridinyl]oxy]propanoate.
| Compound Name | methyl 2,2-dimethyl-3-[[4-methyl-5-[5-[5-(2,2,2-trifluoroethoxy)-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]-2-pyridinyl]-2-pyridinyl]oxy]propanoate |
|---|---|
| PubChem CID | 123283965 |
| Molecular Formula | C27H36F3N5O5Si |
| Molecular Weight | 595.70 g/mol |
| Exact Mass | 595.24 |
| IUPAC Name | methyl 2,2-dimethyl-3-[[4-methyl-5-[5-[5-(2,2,2-trifluoroethoxy)-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]-2-pyridinyl]-2-pyridinyl]oxy]propanoate |
| SMILES | COC(=O)C(C)(C)COc1cc(C)c(-c2ccc(-c3nc(OCC(F)(F)F)n(COCC[Si](C)(C)C)n3)cn2)cn1 |
| InChI | InChI=1S/C27H36F3N5O5Si/c1-18-12-22(39-15-26(2,3)24(36)37-4)32-14-20(18)21-9-8-19(13-31-21)23-33-25(40-16-27(28,29)30)35(34-23)17-38-10-11-41(5,6)7/h8-9,12-14H,10-11,15-17H2,1-7H3 |
| InChIKey | NQUWWLVORWHXIT-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 110.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.70 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|