C15H22IN5O2Si — CID 164718878
3-[hydroxy-(3-iodo-1-methylpyrazol-4-yl)methyl]-1-(2-trimethylsilylethoxymethyl)pyrazole-5-carbonitrile (PubChem CID 164718878) has the molecular formula C15H22IN5O2Si and a molecular weight of 459.36 g/mol. Its IUPAC name is 3-[hydroxy-(3-iodo-1-methylpyrazol-4-yl)methyl]-1-(2-trimethylsilylethoxymethyl)pyrazole-5-carbonitrile.
| Compound Name | 3-[hydroxy-(3-iodo-1-methylpyrazol-4-yl)methyl]-1-(2-trimethylsilylethoxymethyl)pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 164718878 |
| Molecular Formula | C15H22IN5O2Si |
| Molecular Weight | 459.36 g/mol |
| Exact Mass | 459.06 |
| IUPAC Name | 3-[hydroxy-(3-iodo-1-methylpyrazol-4-yl)methyl]-1-(2-trimethylsilylethoxymethyl)pyrazole-5-carbonitrile |
| SMILES | Cn1cc(C(O)c2cc(C#N)n(COCC[Si](C)(C)C)n2)c(I)n1 |
| InChI | InChI=1S/C15H22IN5O2Si/c1-20-9-12(15(16)19-20)14(22)13-7-11(8-17)21(18-13)10-23-5-6-24(2,3)4/h7,9,14,22H,5-6,10H2,1-4H3 |
| InChIKey | KLQAZEYZUNETEE-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 88.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|