C15H22BrF3N2OSi — CID 171769788
2-[[7-bromo-5-methyl-6-(trifluoromethyl)-2,3-dihydroindazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 171769788) has the molecular formula C15H22BrF3N2OSi and a molecular weight of 411.34 g/mol. Its IUPAC name is 2-[[7-bromo-5-methyl-6-(trifluoromethyl)-2,3-dihydroindazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[7-bromo-5-methyl-6-(trifluoromethyl)-2,3-dihydroindazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 171769788 |
| Molecular Formula | C15H22BrF3N2OSi |
| Molecular Weight | 411.34 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 2-[[7-bromo-5-methyl-6-(trifluoromethyl)-2,3-dihydroindazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cc1cc2c(c(Br)c1C(F)(F)F)N(COCC[Si](C)(C)C)NC2 |
| InChI | InChI=1S/C15H22BrF3N2OSi/c1-10-7-11-8-20-21(9-22-5-6-23(2,3)4)14(11)13(16)12(10)15(17,18)19/h7,20H,5-6,8-9H2,1-4H3 |
| InChIKey | PJNYAYAFRXZXEU-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.34 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|