C12H16Br2Cl4N4OSi — CID 159960041
2-bromo-4,5-dichloro-1H-imidazole;2-[(2-bromo-4,5-dichloroimidazol-1-yl)methoxy]ethyl-trimethylsilane (PubChem CID 159960041) has the molecular formula C12H16Br2Cl4N4OSi and a molecular weight of 561.99 g/mol. Its IUPAC name is 2-bromo-4,5-dichloro-1H-imidazole;2-[(2-bromo-4,5-dichloroimidazol-1-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-bromo-4,5-dichloro-1H-imidazole;2-[(2-bromo-4,5-dichloroimidazol-1-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 159960041 |
| Molecular Formula | C12H16Br2Cl4N4OSi |
| Molecular Weight | 561.99 g/mol |
| Exact Mass | 557.82 |
| IUPAC Name | 2-bromo-4,5-dichloro-1H-imidazole;2-[(2-bromo-4,5-dichloroimidazol-1-yl)methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1c(Br)nc(Cl)c1Cl.Clc1nc(Br)[nH]c1Cl |
| InChI | InChI=1S/C9H15BrCl2N2OSi.C3HBrCl2N2/c1-16(2,3)5-4-15-6-14-8(12)7(11)13-9(14)10;4-3-7-1(5)2(6)8-3/h4-6H2,1-3H3;(H,7,8) |
| InChIKey | ODFDCRXICMKZMZ-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.99 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|