C11H15ClFNOS — CID 157058319
2-[2-[(R)-tert-butylsulfinyl]ethyl]-4-chloro-3-fluoropyridine (PubChem CID 157058319) has the molecular formula C11H15ClFNOS and a molecular weight of 263.76 g/mol. Its IUPAC name is 2-[2-[(R)-tert-butylsulfinyl]ethyl]-4-chloro-3-fluoropyridine.
| Compound Name | 2-[2-[(R)-tert-butylsulfinyl]ethyl]-4-chloro-3-fluoropyridine |
|---|---|
| PubChem CID | 157058319 |
| Molecular Formula | C11H15ClFNOS |
| Molecular Weight | 263.76 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 2-[2-[(R)-tert-butylsulfinyl]ethyl]-4-chloro-3-fluoropyridine |
| SMILES | CC(C)(C)[S@](=O)CCc1nccc(Cl)c1F |
| InChI | InChI=1S/C11H15ClFNOS/c1-11(2,3)16(15)7-5-9-10(13)8(12)4-6-14-9/h4,6H,5,7H2,1-3H3/t16-/m1/s1 |
| InChIKey | VKSAOPGBFPMFSY-MRXNPFEDSA-N |
| XLogP | 2.96 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.76 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |