C14H20FNOS — CID 168761550
(4S)-4-(4-fluorophenyl)-2-methylhept-6-ene-2-sulfinamide (PubChem CID 168761550) has the molecular formula C14H20FNOS and a molecular weight of 269.39 g/mol. Its IUPAC name is (4S)-4-(4-fluorophenyl)-2-methylhept-6-ene-2-sulfinamide.
| Compound Name | (4S)-4-(4-fluorophenyl)-2-methylhept-6-ene-2-sulfinamide |
|---|---|
| PubChem CID | 168761550 |
| Molecular Formula | C14H20FNOS |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | (4S)-4-(4-fluorophenyl)-2-methylhept-6-ene-2-sulfinamide |
| SMILES | C=CC[C@@H](CC(C)(C)S(N)=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H20FNOS/c1-4-5-12(10-14(2,3)18(16)17)11-6-8-13(15)9-7-11/h4,6-9,12H,1,5,10,16H2,2-3H3/t12-,18?/m0/s1 |
| InChIKey | KSAJCFUAHYSLQW-RSXQAXDFSA-N |
| XLogP | 3.28 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|