C13H18F3NOS — CID 140876931
(4S)-4-[5-(difluoromethyl)-2-fluorophenyl]-2-methylpentane-2-sulfinamide (PubChem CID 140876931) has the molecular formula C13H18F3NOS and a molecular weight of 293.35 g/mol. Its IUPAC name is (4S)-4-[5-(difluoromethyl)-2-fluorophenyl]-2-methylpentane-2-sulfinamide.
| Compound Name | (4S)-4-[5-(difluoromethyl)-2-fluorophenyl]-2-methylpentane-2-sulfinamide |
|---|---|
| PubChem CID | 140876931 |
| Molecular Formula | C13H18F3NOS |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | (4S)-4-[5-(difluoromethyl)-2-fluorophenyl]-2-methylpentane-2-sulfinamide |
| SMILES | C[C@@H](CC(C)(C)S(N)=O)c1cc(C(F)F)ccc1F |
| InChI | InChI=1S/C13H18F3NOS/c1-8(7-13(2,3)19(17)18)10-6-9(12(15)16)4-5-11(10)14/h4-6,8,12H,7,17H2,1-3H3/t8-,19?/m0/s1 |
| InChIKey | CTBJZCNZVSWEPI-LQABBHMDSA-N |
| XLogP | 3.66 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |