C19H34FNO3SSi — CID 140875586
(4S)-5-[tert-butyl(dimethyl)silyl]oxy-4-(3-fluoro-4-methoxyphenyl)-2-methylpentane-2-sulfinamide (PubChem CID 140875586) has the molecular formula C19H34FNO3SSi and a molecular weight of 403.64 g/mol. Its IUPAC name is (4S)-5-[tert-butyl(dimethyl)silyl]oxy-4-(3-fluoro-4-methoxyphenyl)-2-methylpentane-2-sulfinamide.
| Compound Name | (4S)-5-[tert-butyl(dimethyl)silyl]oxy-4-(3-fluoro-4-methoxyphenyl)-2-methylpentane-2-sulfinamide |
|---|---|
| PubChem CID | 140875586 |
| Molecular Formula | C19H34FNO3SSi |
| Molecular Weight | 403.64 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | (4S)-5-[tert-butyl(dimethyl)silyl]oxy-4-(3-fluoro-4-methoxyphenyl)-2-methylpentane-2-sulfinamide |
| SMILES | COc1ccc([C@@H](CO[Si](C)(C)C(C)(C)C)CC(C)(C)S(N)=O)cc1F |
| InChI | InChI=1S/C19H34FNO3SSi/c1-18(2,3)26(7,8)24-13-15(12-19(4,5)25(21)22)14-9-10-17(23-6)16(20)11-14/h9-11,15H,12-13,21H2,1-8H3/t15-,25?/m1/s1 |
| InChIKey | SUTZROJEFPKFBA-FXBVVIMESA-N |
| XLogP | 4.73 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.64 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|