C21H31FN2O4Si — CID 66885295
methyl 2-[5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]imidazol-1-yl]-2-(3-fluoro-4-methoxyphenyl)acetate (PubChem CID 66885295) has the molecular formula C21H31FN2O4Si and a molecular weight of 422.57 g/mol. Its IUPAC name is methyl 2-[5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]imidazol-1-yl]-2-(3-fluoro-4-methoxyphenyl)acetate.
| Compound Name | methyl 2-[5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]imidazol-1-yl]-2-(3-fluoro-4-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 66885295 |
| Molecular Formula | C21H31FN2O4Si |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | methyl 2-[5-[2-[tert-butyl(dimethyl)silyl]oxyethyl]imidazol-1-yl]-2-(3-fluoro-4-methoxyphenyl)acetate |
| SMILES | COC(=O)C(c1ccc(OC)c(F)c1)n1cncc1CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H31FN2O4Si/c1-21(2,3)29(6,7)28-11-10-16-13-23-14-24(16)19(20(25)27-5)15-8-9-18(26-4)17(22)12-15/h8-9,12-14,19H,10-11H2,1-7H3 |
| InChIKey | BBMGQNWIPDLBBZ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|