C21H24FNO3 — CID 90346607
[(3S)-3-(4-fluorophenyl)hex-5-enyl]-[(1S)-1-(4-hydroxyphenyl)ethyl]carbamic acid (PubChem CID 90346607) has the molecular formula C21H24FNO3 and a molecular weight of 357.43 g/mol. Its IUPAC name is [(3S)-3-(4-fluorophenyl)hex-5-enyl]-[(1S)-1-(4-hydroxyphenyl)ethyl]carbamic acid.
| Compound Name | [(3S)-3-(4-fluorophenyl)hex-5-enyl]-[(1S)-1-(4-hydroxyphenyl)ethyl]carbamic acid |
|---|---|
| PubChem CID | 90346607 |
| Molecular Formula | C21H24FNO3 |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | [(3S)-3-(4-fluorophenyl)hex-5-enyl]-[(1S)-1-(4-hydroxyphenyl)ethyl]carbamic acid |
| SMILES | C=CCC(CCN(C(=O)O)[C@@H](C)c1ccc(O)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H24FNO3/c1-3-4-17(18-5-9-19(22)10-6-18)13-14-23(21(25)26)15(2)16-7-11-20(24)12-8-16/h3,5-12,15,17,24H,1,4,13-14H2,2H3,(H,25,26)/t15-,17?/m0/s1 |
| InChIKey | NGFOSQSTVRQJOF-MYJWUSKBSA-N |
| XLogP | 5.32 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|