C15H24INOS — CID 124640307
(S)-N-[(1S)-1-(4-iodophenyl)-3-methylbutyl]-2-methylpropane-2-sulfinamide (PubChem CID 124640307) has the molecular formula C15H24INOS and a molecular weight of 393.33 g/mol. Its IUPAC name is (S)-N-[(1S)-1-(4-iodophenyl)-3-methylbutyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (S)-N-[(1S)-1-(4-iodophenyl)-3-methylbutyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 124640307 |
| Molecular Formula | C15H24INOS |
| Molecular Weight | 393.33 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | (S)-N-[(1S)-1-(4-iodophenyl)-3-methylbutyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)C[C@H](N[S@@](=O)C(C)(C)C)c1ccc(I)cc1 |
| InChI | InChI=1S/C15H24INOS/c1-11(2)10-14(17-19(18)15(3,4)5)12-6-8-13(16)9-7-12/h6-9,11,14,17H,10H2,1-5H3/t14-,19-/m0/s1 |
| InChIKey | MBSXSUNLZWMHFT-LIRRHRJNSA-N |
| XLogP | 4.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.33 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|