C15H20BrF2NO3S — CID 163484354
ethyl (3S)-3-(5-bromo-2,3-difluorophenyl)-3-[[(S)-tert-butylsulfinyl]amino]propanoate (PubChem CID 163484354) has the molecular formula C15H20BrF2NO3S and a molecular weight of 412.30 g/mol. Its IUPAC name is ethyl (3S)-3-(5-bromo-2,3-difluorophenyl)-3-[[(S)-tert-butylsulfinyl]amino]propanoate.
| Compound Name | ethyl (3S)-3-(5-bromo-2,3-difluorophenyl)-3-[[(S)-tert-butylsulfinyl]amino]propanoate |
|---|---|
| PubChem CID | 163484354 |
| Molecular Formula | C15H20BrF2NO3S |
| Molecular Weight | 412.30 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | ethyl (3S)-3-(5-bromo-2,3-difluorophenyl)-3-[[(S)-tert-butylsulfinyl]amino]propanoate |
| SMILES | CCOC(=O)C[C@H](N[S@@](=O)C(C)(C)C)c1cc(Br)cc(F)c1F |
| InChI | InChI=1S/C15H20BrF2NO3S/c1-5-22-13(20)8-12(19-23(21)15(2,3)4)10-6-9(16)7-11(17)14(10)18/h6-7,12,19H,5,8H2,1-4H3/t12-,23-/m0/s1 |
| InChIKey | CHGXXRBIRBXOPB-MYODQAERSA-N |
| XLogP | 3.77 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.30 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|