C24H30F2NO2S- — CID 167131088
CID 167131088 (PubChem CID 167131088) has the molecular formula C24H30F2NO2S- and a molecular weight of 434.57 g/mol.
| Compound Name | CID 167131088 |
|---|---|
| PubChem CID | 167131088 |
| Molecular Formula | C24H30F2NO2S- |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | — |
| SMILES | C#[S-](N[C@@H](CC(=O)OCC)c1cc(-c2c(C)cccc2C)cc(F)c1F)C(C)(C)C |
| InChI | InChI=1S/C24H30F2NO2S/c1-8-29-21(28)14-20(27-30(7)24(4,5)6)18-12-17(13-19(25)23(18)26)22-15(2)10-9-11-16(22)3/h7,9-13,20,27H,8,14H2,1-6H3/q-1/t20-/m0/s1 |
| InChIKey | OBNGWJNQDGGQKQ-FQEVSTJZSA-N |
| XLogP | 5.75 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|