C32H36ClF2N3O4 — CID 178070200
ethyl (3S)-3-[[(2S)-2-[(6-chloro-2-pyridinyl)carbamoyl]-4-methylpentanoyl]amino]-3-[2-fluoro-5-(4-fluoro-2,6-dimethylphenyl)-3-methylphenyl]propanoate (PubChem CID 178070200) has the molecular formula C32H36ClF2N3O4 and a molecular weight of 600.11 g/mol. Its IUPAC name is ethyl (3S)-3-[[(2S)-2-[(6-chloro-2-pyridinyl)carbamoyl]-4-methylpentanoyl]amino]-3-[2-fluoro-5-(4-fluoro-2,6-dimethylphenyl)-3-methylphenyl]propanoate.
| Compound Name | ethyl (3S)-3-[[(2S)-2-[(6-chloro-2-pyridinyl)carbamoyl]-4-methylpentanoyl]amino]-3-[2-fluoro-5-(4-fluoro-2,6-dimethylphenyl)-3-methylphenyl]propanoate |
|---|---|
| PubChem CID | 178070200 |
| Molecular Formula | C32H36ClF2N3O4 |
| Molecular Weight | 600.11 g/mol |
| Exact Mass | 599.24 |
| IUPAC Name | ethyl (3S)-3-[[(2S)-2-[(6-chloro-2-pyridinyl)carbamoyl]-4-methylpentanoyl]amino]-3-[2-fluoro-5-(4-fluoro-2,6-dimethylphenyl)-3-methylphenyl]propanoate |
| SMILES | CCOC(=O)C[C@H](NC(=O)[C@H](CC(C)C)C(=O)Nc1cccc(Cl)n1)c1cc(-c2c(C)cc(F)cc2C)cc(C)c1F |
| InChI | InChI=1S/C32H36ClF2N3O4/c1-7-42-28(39)16-25(23-15-21(12-20(6)30(23)35)29-18(4)13-22(34)14-19(29)5)36-31(40)24(11-17(2)3)32(41)38-27-10-8-9-26(33)37-27/h8-10,12-15,17,24-25H,7,11,16H2,1-6H3,(H,36,40)(H,37,38,41)/t24-,25-/m0/s1 |
| InChIKey | YRAAUBJJZDGZKT-DQEYMECFSA-N |
| XLogP | 7.02 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.11 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|