C33H37F3N4O4 — CID 178070212
ethyl (3S)-3-[2,3-difluoro-5-(4-fluoro-2,6-dimethylphenyl)phenyl]-3-[[(2S)-2-(6,7-dihydro-5H-pyrrolo[3,4-b]pyridin-2-ylcarbamoyl)-4-methylpentanoyl]amino]propanoate (PubChem CID 178070212) has the molecular formula C33H37F3N4O4 and a molecular weight of 610.68 g/mol. Its IUPAC name is ethyl (3S)-3-[2,3-difluoro-5-(4-fluoro-2,6-dimethylphenyl)phenyl]-3-[[(2S)-2-(6,7-dihydro-5H-pyrrolo[3,4-b]pyridin-2-ylcarbamoyl)-4-methylpentanoyl]amino]propanoate.
| Compound Name | ethyl (3S)-3-[2,3-difluoro-5-(4-fluoro-2,6-dimethylphenyl)phenyl]-3-[[(2S)-2-(6,7-dihydro-5H-pyrrolo[3,4-b]pyridin-2-ylcarbamoyl)-4-methylpentanoyl]amino]propanoate |
|---|---|
| PubChem CID | 178070212 |
| Molecular Formula | C33H37F3N4O4 |
| Molecular Weight | 610.68 g/mol |
| Exact Mass | 610.28 |
| IUPAC Name | ethyl (3S)-3-[2,3-difluoro-5-(4-fluoro-2,6-dimethylphenyl)phenyl]-3-[[(2S)-2-(6,7-dihydro-5H-pyrrolo[3,4-b]pyridin-2-ylcarbamoyl)-4-methylpentanoyl]amino]propanoate |
| SMILES | CCOC(=O)C[C@H](NC(=O)C(CC(C)C)C(=O)Nc1ccc2c(n1)CNC2)c1cc(-c2c(C)cc(F)cc2C)cc(F)c1F |
| InChI | InChI=1S/C33H37F3N4O4/c1-6-44-29(41)14-26(23-12-21(13-25(35)31(23)36)30-18(4)10-22(34)11-19(30)5)39-32(42)24(9-17(2)3)33(43)40-28-8-7-20-15-37-16-27(20)38-28/h7-8,10-13,17,24,26,37H,6,9,14-16H2,1-5H3,(H,39,42)(H,38,40,43)/t24?,26-/m0/s1 |
| InChIKey | GMSABICBJCKHFM-JKGBFCRXSA-N |
| XLogP | 5.80 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.68 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|