C13H19BrN2O3S — CID 175797647
[[(1S)-1-(2-bromo-4-pyridinyl)-3-ethoxy-3-oxopropyl]amino]-oxido-propan-2-ylsulfanium (PubChem CID 175797647) has the molecular formula C13H19BrN2O3S and a molecular weight of 363.28 g/mol. Its IUPAC name is [[(1S)-1-(2-bromo-4-pyridinyl)-3-ethoxy-3-oxopropyl]amino]-oxido-propan-2-ylsulfanium.
| Compound Name | [[(1S)-1-(2-bromo-4-pyridinyl)-3-ethoxy-3-oxopropyl]amino]-oxido-propan-2-ylsulfanium |
|---|---|
| PubChem CID | 175797647 |
| Molecular Formula | C13H19BrN2O3S |
| Molecular Weight | 363.28 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | [[(1S)-1-(2-bromo-4-pyridinyl)-3-ethoxy-3-oxopropyl]amino]-oxido-propan-2-ylsulfanium |
| SMILES | CCOC(=O)C[C@H](N[S+]([O-])C(C)C)c1ccnc(Br)c1 |
| InChI | InChI=1S/C13H19BrN2O3S/c1-4-19-13(17)8-11(16-20(18)9(2)3)10-5-6-15-12(14)7-10/h5-7,9,11,16H,4,8H2,1-3H3/t11-,20?/m0/s1 |
| InChIKey | CMRSBFKWCZXOHK-ZOZMEPSFSA-N |
| XLogP | 2.50 |
| TPSA | 74.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|