C32H50N2O5S — CID 159493673
methyl 4-[(1R)-1-aminohexyl]benzoate;methyl 4-[(1R)-1-[[(S)-tert-butylsulfinyl]amino]hexyl]benzoate (PubChem CID 159493673) has the molecular formula C32H50N2O5S and a molecular weight of 574.83 g/mol. Its IUPAC name is methyl 4-[(1R)-1-aminohexyl]benzoate;methyl 4-[(1R)-1-[[(S)-tert-butylsulfinyl]amino]hexyl]benzoate.
| Compound Name | methyl 4-[(1R)-1-aminohexyl]benzoate;methyl 4-[(1R)-1-[[(S)-tert-butylsulfinyl]amino]hexyl]benzoate |
|---|---|
| PubChem CID | 159493673 |
| Molecular Formula | C32H50N2O5S |
| Molecular Weight | 574.83 g/mol |
| Exact Mass | 574.34 |
| IUPAC Name | methyl 4-[(1R)-1-aminohexyl]benzoate;methyl 4-[(1R)-1-[[(S)-tert-butylsulfinyl]amino]hexyl]benzoate |
| SMILES | CCCCC[C@@H](N)c1ccc(C(=O)OC)cc1.CCCCC[C@@H](N[S@@](=O)C(C)(C)C)c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C18H29NO3S.C14H21NO2/c1-6-7-8-9-16(19-23(21)18(2,3)4)14-10-12-15(13-11-14)17(20)22-5;1-3-4-5-6-13(15)11-7-9-12(10-8-11)14(16)17-2/h10-13,16,19H,6-9H2,1-5H3;7-10,13H,3-6,15H2,1-2H3/t16-,23+;13-/m11/s1 |
| InChIKey | LYMVNQIZZIIDTG-KEFKZFORSA-N |
| XLogP | 7.20 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.83 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|