C20H16F2N2O2S — CID 134945741
N'-[(1R)-2,2-difluoro-3-oxo-3-phenyl-1-thiophen-2-ylpropyl]benzohydrazide (PubChem CID 134945741) has the molecular formula C20H16F2N2O2S and a molecular weight of 386.42 g/mol. Its IUPAC name is N'-[(1R)-2,2-difluoro-3-oxo-3-phenyl-1-thiophen-2-ylpropyl]benzohydrazide.
| Compound Name | N'-[(1R)-2,2-difluoro-3-oxo-3-phenyl-1-thiophen-2-ylpropyl]benzohydrazide |
|---|---|
| PubChem CID | 134945741 |
| Molecular Formula | C20H16F2N2O2S |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | N'-[(1R)-2,2-difluoro-3-oxo-3-phenyl-1-thiophen-2-ylpropyl]benzohydrazide |
| SMILES | O=C(NN[C@@H](c1cccs1)C(F)(F)C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H16F2N2O2S/c21-20(22,18(25)14-8-3-1-4-9-14)17(16-12-7-13-27-16)23-24-19(26)15-10-5-2-6-11-15/h1-13,17,23H,(H,24,26)/t17-/m0/s1 |
| InChIKey | QCWLGWGKRWUWSM-KRWDZBQOSA-N |
| XLogP | 4.24 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|