About N'-[(2R,3S)-2-(4-bromophenyl)-3-methylpent-4-en-2-yl]benzohydrazide
N'-[(2R,3S)-2-(4-bromophenyl)-3-methylpent-4-en-2-yl]benzohydrazide (PubChem CID 101191316) has the molecular formula C19H21BrN2O
and a molecular weight of 373.29 g/mol. Its IUPAC name is N'-[(2R,3S)-2-(4-bromophenyl)-3-methylpent-4-en-2-yl]benzohydrazide.
Molecular Properties
| Compound Name | N'-[(2R,3S)-2-(4-bromophenyl)-3-methylpent-4-en-2-yl]benzohydrazide |
| PubChem CID | 101191316 |
| Molecular Formula | C19H21BrN2O |
| Molecular Weight | 373.29 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | N'-[(2R,3S)-2-(4-bromophenyl)-3-methylpent-4-en-2-yl]benzohydrazide |
| SMILES | C=C[C@H](C)[C@@](C)(NNC(=O)c1ccccc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H21BrN2O/c1-4-14(2)19(3,16-10-12-17(20)13-11-16)22-21-18(23)15-8-6-5-7-9-15/h4-14,22H,1H2,2-3H3,(H,21,23)/t14-,19+/m0/s1 |
| InChIKey | DYXJSYXYJPHPIC-IFXJQAMLSA-N |
| XLogP | 4.42 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.29 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-[(2R,3S)-2-(4-bromophenyl)-3-methylpent-4-en-2-yl]benzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(2R,3S)-2-(4-bromophenyl)-3-methylpent-4-en-2-yl]benzohydrazide?
The IUPAC name of N'-[(2R,3S)-2-(4-bromophenyl)-3-methylpent-4-en-2-yl]benzohydrazide (CID 101191316) is N'-[(2R,3S)-2-(4-bromophenyl)-3-methylpent-4-en-2-yl]benzohydrazide.
What is the SMILES notation for N'-[(2R,3S)-2-(4-bromophenyl)-3-methylpent-4-en-2-yl]benzohydrazide?
The canonical SMILES for N'-[(2R,3S)-2-(4-bromophenyl)-3-methylpent-4-en-2-yl]benzohydrazide is C=C[C@H](C)[C@@](C)(NNC(=O)c1ccccc1)c1ccc(Br)cc1.
What is the InChIKey of N'-[(2R,3S)-2-(4-bromophenyl)-3-methylpent-4-en-2-yl]benzohydrazide?
The InChIKey is DYXJSYXYJPHPIC-IFXJQAMLSA-N. The full InChI is InChI=1S/C19H21BrN2O/c1-4-14(2)19(3,16-10-12-17(20)13-11-16)22-21-18(23)15-8-6-5-7-9-15/h4-14,22H,1H2,2-3H3,(H,21,23)/t14-,19+/m0/s1.
What are the key properties of N'-[(2R,3S)-2-(4-bromophenyl)-3-methylpent-4-en-2-yl]benzohydrazide?
N'-[(2R,3S)-2-(4-bromophenyl)-3-methylpent-4-en-2-yl]benzohydrazide has a molecular weight of 373.29 g/mol, XLogP of 4.42, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(2R,3S)-2-(4-bromophenyl)-3-methylpent-4-en-2-yl]benzohydrazide is sourced from PubChem (CID 101191316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).