C13H18NNaO4S — CID 174882584
sodium;hydride;phenyl 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonate (PubChem CID 174882584) has the molecular formula C13H18NNaO4S and a molecular weight of 307.35 g/mol. Its IUPAC name is sodium;hydride;phenyl 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonate.
| Compound Name | sodium;hydride;phenyl 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonate |
|---|---|
| PubChem CID | 174882584 |
| Molecular Formula | C13H18NNaO4S |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | sodium;hydride;phenyl 2-methyl-2-(prop-2-enoylamino)propane-1-sulfonate |
| SMILES | C=CC(=O)NC(C)(C)CS(=O)(=O)Oc1ccccc1.[H-].[Na+] |
| InChI | InChI=1S/C13H17NO4S.Na.H/c1-4-12(15)14-13(2,3)10-19(16,17)18-11-8-6-5-7-9-11;;/h4-9H,1,10H2,2-3H3,(H,14,15);;/q;+1;-1 |
| InChIKey | JZCFRRLKJPUYBT-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|