About benzamido propane-1-sulfonate
benzamido propane-1-sulfonate (PubChem CID 141165676) has the molecular formula C10H13NO4S
and a molecular weight of 243.28 g/mol. Its IUPAC name is benzamido propane-1-sulfonate.
Molecular Properties
| Compound Name | benzamido propane-1-sulfonate |
| PubChem CID | 141165676 |
| Molecular Formula | C10H13NO4S |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | benzamido propane-1-sulfonate |
| SMILES | CCCS(=O)(=O)ONC(=O)c1ccccc1 |
| InChI | InChI=1S/C10H13NO4S/c1-2-8-16(13,14)15-11-10(12)9-6-4-3-5-7-9/h3-7H,2,8H2,1H3,(H,11,12) |
| InChIKey | NTHOKIPPCBANRL-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzamido propane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzamido propane-1-sulfonate?
The IUPAC name of benzamido propane-1-sulfonate (CID 141165676) is benzamido propane-1-sulfonate.
What is the SMILES notation for benzamido propane-1-sulfonate?
The canonical SMILES for benzamido propane-1-sulfonate is CCCS(=O)(=O)ONC(=O)c1ccccc1.
What is the InChIKey of benzamido propane-1-sulfonate?
The InChIKey is NTHOKIPPCBANRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO4S/c1-2-8-16(13,14)15-11-10(12)9-6-4-3-5-7-9/h3-7H,2,8H2,1H3,(H,11,12).
What are the key properties of benzamido propane-1-sulfonate?
benzamido propane-1-sulfonate has a molecular weight of 243.28 g/mol, XLogP of 1.09, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzamido propane-1-sulfonate is sourced from PubChem (CID 141165676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).